C15H28O3 — CID 139766609
pentadeca-1,3-diene-1,1,2-triol (PubChem CID 139766609) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is pentadeca-1,3-diene-1,1,2-triol.
| Compound Name | pentadeca-1,3-diene-1,1,2-triol |
|---|---|
| PubChem CID | 139766609 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | pentadeca-1,3-diene-1,1,2-triol |
| SMILES | CCCCCCCCCCCC=CC(O)=C(O)O |
| InChI | InChI=1S/C15H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15(17)18/h12-13,16-18H,2-11H2,1H3 |
| InChIKey | JMHHNYBKPRFIJY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|