C13H22O3 — CID 139766523
trideca-1,3,5-triene-1,1,2-triol (PubChem CID 139766523) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is trideca-1,3,5-triene-1,1,2-triol.
| Compound Name | trideca-1,3,5-triene-1,1,2-triol |
|---|---|
| PubChem CID | 139766523 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | trideca-1,3,5-triene-1,1,2-triol |
| SMILES | CCCCCCCC=CC=CC(O)=C(O)O |
| InChI | InChI=1S/C13H22O3/c1-2-3-4-5-6-7-8-9-10-11-12(14)13(15)16/h8-11,14-16H,2-7H2,1H3 |
| InChIKey | ISBHUVLQLYULMG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|