C18H30O3 — CID 139766689
octadeca-1,3,5,7-tetraene-1,1,2-triol (PubChem CID 139766689) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is octadeca-1,3,5,7-tetraene-1,1,2-triol.
| Compound Name | octadeca-1,3,5,7-tetraene-1,1,2-triol |
|---|---|
| PubChem CID | 139766689 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | octadeca-1,3,5,7-tetraene-1,1,2-triol |
| SMILES | CCCCCCCCCCC=CC=CC=CC(O)=C(O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h11-16,19-21H,2-10H2,1H3 |
| InChIKey | VRNWSXJAJMMPKX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|