C16H32 — CID 145000899
(4E)-2,3-dimethyldodeca-1,4-diene;ethane (PubChem CID 145000899) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is (4E)-2,3-dimethyldodeca-1,4-diene;ethane.
| Compound Name | (4E)-2,3-dimethyldodeca-1,4-diene;ethane |
|---|---|
| PubChem CID | 145000899 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | (4E)-2,3-dimethyldodeca-1,4-diene;ethane |
| SMILES | C=C(C)C(C)/C=C/CCCCCCC.CC |
| InChI | InChI=1S/C14H26.C2H6/c1-5-6-7-8-9-10-11-12-14(4)13(2)3;1-2/h11-12,14H,2,5-10H2,1,3-4H3;1-2H3/b12-11+; |
| InChIKey | DSGNZTBOMFLKMH-CALJPSDSSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|