About (Z)-2-methyloct-3-ene;octane
(Z)-2-methyloct-3-ene;octane (PubChem CID 159051061) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is (Z)-2-methyloct-3-ene;octane.
Molecular Properties
| Compound Name | (Z)-2-methyloct-3-ene;octane |
| PubChem CID | 159051061 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | (Z)-2-methyloct-3-ene;octane |
| SMILES | CCCC/C=C\C(C)C.CCCCCCCC |
| InChI | InChI=1S/C9H18.C8H18/c1-4-5-6-7-8-9(2)3;1-3-5-7-8-6-4-2/h7-9H,4-6H2,1-3H3;3-8H2,1-2H3/b8-7-; |
| InChIKey | JXGSCCROTPICQX-CFYXSCKTSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methyloct-3-ene;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methyloct-3-ene;octane?
The IUPAC name of (Z)-2-methyloct-3-ene;octane (CID 159051061) is (Z)-2-methyloct-3-ene;octane.
What is the SMILES notation for (Z)-2-methyloct-3-ene;octane?
The canonical SMILES for (Z)-2-methyloct-3-ene;octane is CCCC/C=C\C(C)C.CCCCCCCC.
What is the InChIKey of (Z)-2-methyloct-3-ene;octane?
The InChIKey is JXGSCCROTPICQX-CFYXSCKTSA-N. The full InChI is InChI=1S/C9H18.C8H18/c1-4-5-6-7-8-9(2)3;1-3-5-7-8-6-4-2/h7-9H,4-6H2,1-3H3;3-8H2,1-2H3/b8-7-;.
What are the key properties of (Z)-2-methyloct-3-ene;octane?
(Z)-2-methyloct-3-ene;octane has a molecular weight of 240.47 g/mol, XLogP of 6.76, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methyloct-3-ene;octane is sourced from PubChem (CID 159051061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).