About 2-methylhexadeca-3,5-diene
2-methylhexadeca-3,5-diene (PubChem CID 140995829) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 2-methylhexadeca-3,5-diene.
Molecular Properties
| Compound Name | 2-methylhexadeca-3,5-diene |
| PubChem CID | 140995829 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 2-methylhexadeca-3,5-diene |
| SMILES | CCCCCCCCCCC=CC=CC(C)C |
| InChI | InChI=1S/C17H32/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h13-17H,4-12H2,1-3H3 |
| InChIKey | DLKOFXARFXFUAS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexadeca-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexadeca-3,5-diene?
The IUPAC name of 2-methylhexadeca-3,5-diene (CID 140995829) is 2-methylhexadeca-3,5-diene.
What is the SMILES notation for 2-methylhexadeca-3,5-diene?
The canonical SMILES for 2-methylhexadeca-3,5-diene is CCCCCCCCCCC=CC=CC(C)C.
What is the InChIKey of 2-methylhexadeca-3,5-diene?
The InChIKey is DLKOFXARFXFUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h13-17H,4-12H2,1-3H3.
What are the key properties of 2-methylhexadeca-3,5-diene?
2-methylhexadeca-3,5-diene has a molecular weight of 236.44 g/mol, XLogP of 6.29, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexadeca-3,5-diene is sourced from PubChem (CID 140995829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).