C12H23N — CID 14864066
(3E,5Z)-dodeca-3,5-dien-2-amine (PubChem CID 14864066) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E,5Z)-dodeca-3,5-dien-2-amine.
| Compound Name | (3E,5Z)-dodeca-3,5-dien-2-amine |
|---|---|
| PubChem CID | 14864066 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E,5Z)-dodeca-3,5-dien-2-amine |
| SMILES | CCCCCC/C=C\C=C\C(C)N |
| InChI | InChI=1S/C12H23N/c1-3-4-5-6-7-8-9-10-11-12(2)13/h8-12H,3-7,13H2,1-2H3/b9-8-,11-10+ |
| InChIKey | LNNSMFKRGGYANY-QNRZBPGKSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|