C11H24N2 — CID 141374365
1-N'-non-1-enylethane-1,1-diamine (PubChem CID 141374365) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-N'-non-1-enylethane-1,1-diamine.
| Compound Name | 1-N'-non-1-enylethane-1,1-diamine |
|---|---|
| PubChem CID | 141374365 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-N'-non-1-enylethane-1,1-diamine |
| SMILES | CCCCCCCC=CNC(C)N |
| InChI | InChI=1S/C11H24N2/c1-3-4-5-6-7-8-9-10-13-11(2)12/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | FCNRUHNNUYHUOG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|