About dodeca-3,5-dien-2-amine
dodeca-3,5-dien-2-amine (PubChem CID 72740287) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is dodeca-3,5-dien-2-amine.
Molecular Properties
| Compound Name | dodeca-3,5-dien-2-amine |
| PubChem CID | 72740287 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | dodeca-3,5-dien-2-amine |
| SMILES | CCCCCCC=CC=CC(C)N |
| InChI | InChI=1S/C12H23N/c1-3-4-5-6-7-8-9-10-11-12(2)13/h8-12H,3-7,13H2,1-2H3 |
| InChIKey | LNNSMFKRGGYANY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dodeca-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-3,5-dien-2-amine?
The IUPAC name of dodeca-3,5-dien-2-amine (CID 72740287) is dodeca-3,5-dien-2-amine.
What is the SMILES notation for dodeca-3,5-dien-2-amine?
The canonical SMILES for dodeca-3,5-dien-2-amine is CCCCCCC=CC=CC(C)N.
What is the InChIKey of dodeca-3,5-dien-2-amine?
The InChIKey is LNNSMFKRGGYANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-3-4-5-6-7-8-9-10-11-12(2)13/h8-12H,3-7,13H2,1-2H3.
What are the key properties of dodeca-3,5-dien-2-amine?
dodeca-3,5-dien-2-amine has a molecular weight of 181.32 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-3,5-dien-2-amine is sourced from PubChem (CID 72740287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).