C13H24N2O — CID 170875725
(4E,6E)-3-aminotrideca-4,6-dienamide (PubChem CID 170875725) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (4E,6E)-3-aminotrideca-4,6-dienamide.
| Compound Name | (4E,6E)-3-aminotrideca-4,6-dienamide |
|---|---|
| PubChem CID | 170875725 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (4E,6E)-3-aminotrideca-4,6-dienamide |
| SMILES | CCCCCC/C=C/C=C/C(N)CC(N)=O |
| InChI | InChI=1S/C13H24N2O/c1-2-3-4-5-6-7-8-9-10-12(14)11-13(15)16/h7-10,12H,2-6,11,14H2,1H3,(H2,15,16)/b8-7+,10-9+ |
| InChIKey | XOFZFTUPQGXIND-XBLVEGMJSA-N |
| XLogP | 2.27 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|