C14H25N — CID 14864063
(3E,5E)-tetradeca-3,5,13-trien-2-amine (PubChem CID 14864063) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (3E,5E)-tetradeca-3,5,13-trien-2-amine.
| Compound Name | (3E,5E)-tetradeca-3,5,13-trien-2-amine |
|---|---|
| PubChem CID | 14864063 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (3E,5E)-tetradeca-3,5,13-trien-2-amine |
| SMILES | C=CCCCCCC/C=C/C=C/C(C)N |
| InChI | InChI=1S/C14H25N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h3,10-14H,1,4-9,15H2,2H3/b11-10+,13-12+ |
| InChIKey | HHJQIQYLOSKHKZ-AQASXUMVSA-N |
| XLogP | 3.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|