C13H23Cl — CID 171485746
(3Z,5E)-12-chloro-2-methyldodeca-3,5-diene (PubChem CID 171485746) has the molecular formula C13H23Cl and a molecular weight of 214.78 g/mol. Its IUPAC name is (3Z,5E)-12-chloro-2-methyldodeca-3,5-diene.
| Compound Name | (3Z,5E)-12-chloro-2-methyldodeca-3,5-diene |
|---|---|
| PubChem CID | 171485746 |
| Molecular Formula | C13H23Cl |
| Molecular Weight | 214.78 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (3Z,5E)-12-chloro-2-methyldodeca-3,5-diene |
| SMILES | CC(C)/C=C\C=C\CCCCCCCl |
| InChI | InChI=1S/C13H23Cl/c1-13(2)11-9-7-5-3-4-6-8-10-12-14/h5,7,9,11,13H,3-4,6,8,10,12H2,1-2H3/b7-5+,11-9- |
| InChIKey | GZVRHYXGXICWDD-STRRHFTISA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|