C15H27Cl — CID 171472271
14-chloro-4-methyltetradeca-5,7-diene (PubChem CID 171472271) has the molecular formula C15H27Cl and a molecular weight of 242.83 g/mol. Its IUPAC name is 14-chloro-4-methyltetradeca-5,7-diene.
| Compound Name | 14-chloro-4-methyltetradeca-5,7-diene |
|---|---|
| PubChem CID | 171472271 |
| Molecular Formula | C15H27Cl |
| Molecular Weight | 242.83 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 14-chloro-4-methyltetradeca-5,7-diene |
| SMILES | CCCC(C)C=CC=CCCCCCCCl |
| InChI | InChI=1S/C15H27Cl/c1-3-12-15(2)13-10-8-6-4-5-7-9-11-14-16/h6,8,10,13,15H,3-5,7,9,11-12,14H2,1-2H3 |
| InChIKey | XQWKPSDMLWXEEB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.83 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|