C10H18O2 — CID 130238346
deca-1,5-diene-3,4-diol (PubChem CID 130238346) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is deca-1,5-diene-3,4-diol.
| Compound Name | deca-1,5-diene-3,4-diol |
|---|---|
| PubChem CID | 130238346 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | deca-1,5-diene-3,4-diol |
| SMILES | C=CC(O)C(O)C=CCCCC |
| InChI | InChI=1S/C10H18O2/c1-3-5-6-7-8-10(12)9(11)4-2/h4,7-12H,2-3,5-6H2,1H3 |
| InChIKey | FWCVNYDCCRQOCD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|