About (E)-hept-2-ene-1,1-diol
(E)-hept-2-ene-1,1-diol (PubChem CID 87660901) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (E)-hept-2-ene-1,1-diol.
Molecular Properties
| Compound Name | (E)-hept-2-ene-1,1-diol |
| PubChem CID | 87660901 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (E)-hept-2-ene-1,1-diol |
| SMILES | CCCC/C=C/C(O)O |
| InChI | InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h5-9H,2-4H2,1H3/b6-5+ |
| InChIKey | GEQJXGIPJQJINW-AATRIKPKSA-N |
| XLogP | 1.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hept-2-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hept-2-ene-1,1-diol?
The IUPAC name of (E)-hept-2-ene-1,1-diol (CID 87660901) is (E)-hept-2-ene-1,1-diol.
What is the SMILES notation for (E)-hept-2-ene-1,1-diol?
The canonical SMILES for (E)-hept-2-ene-1,1-diol is CCCC/C=C/C(O)O.
What is the InChIKey of (E)-hept-2-ene-1,1-diol?
The InChIKey is GEQJXGIPJQJINW-AATRIKPKSA-N. The full InChI is InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h5-9H,2-4H2,1H3/b6-5+.
What are the key properties of (E)-hept-2-ene-1,1-diol?
(E)-hept-2-ene-1,1-diol has a molecular weight of 130.19 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hept-2-ene-1,1-diol is sourced from PubChem (CID 87660901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).