C13H24O3 — CID 134992697
(2E,4S,5S,6E)-4-(methoxymethoxy)undeca-2,6-dien-5-ol (PubChem CID 134992697) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (2E,4S,5S,6E)-4-(methoxymethoxy)undeca-2,6-dien-5-ol.
| Compound Name | (2E,4S,5S,6E)-4-(methoxymethoxy)undeca-2,6-dien-5-ol |
|---|---|
| PubChem CID | 134992697 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2E,4S,5S,6E)-4-(methoxymethoxy)undeca-2,6-dien-5-ol |
| SMILES | C/C=C/[C@H](OCOC)[C@@H](O)/C=C/CCCC |
| InChI | InChI=1S/C13H24O3/c1-4-6-7-8-10-12(14)13(9-5-2)16-11-15-3/h5,8-10,12-14H,4,6-7,11H2,1-3H3/b9-5+,10-8+/t12-,13-/m0/s1 |
| InChIKey | AEQFBDCGMJWMNS-QFGHBFJKSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|