C18H38O2Sn — CID 12839862
tributyl-[(E,1S)-1-(methoxymethoxy)but-2-enyl]stannane (PubChem CID 12839862) has the molecular formula C18H38O2Sn and a molecular weight of 405.21 g/mol. Its IUPAC name is tributyl-[(E,1S)-1-(methoxymethoxy)but-2-enyl]stannane.
| Compound Name | tributyl-[(E,1S)-1-(methoxymethoxy)but-2-enyl]stannane |
|---|---|
| PubChem CID | 12839862 |
| Molecular Formula | C18H38O2Sn |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | tributyl-[(E,1S)-1-(methoxymethoxy)but-2-enyl]stannane |
| SMILES | C/C=C/[C@@H](OCOC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H11O2.3C4H9.Sn/c1-3-4-5-8-6-7-2;3*1-3-4-2;/h3-5H,6H2,1-2H3;3*1,3-4H2,2H3;/b4-3+;;;; |
| InChIKey | FVUIUPLNKMLNIA-PLJHVDPMSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|