C20H42Sn — CID 177449135
tributyl-[(Z,4R)-oct-2-en-4-yl]stannane (PubChem CID 177449135) has the molecular formula C20H42Sn and a molecular weight of 401.27 g/mol. Its IUPAC name is tributyl-[(Z,4R)-oct-2-en-4-yl]stannane.
| Compound Name | tributyl-[(Z,4R)-oct-2-en-4-yl]stannane |
|---|---|
| PubChem CID | 177449135 |
| Molecular Formula | C20H42Sn |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tributyl-[(Z,4R)-oct-2-en-4-yl]stannane |
| SMILES | C/C=C\[C@@H](CCCC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C8H15.3C4H9.Sn/c1-3-5-7-8-6-4-2;3*1-3-4-2;/h3,5,7H,4,6,8H2,1-2H3;3*1,3-4H2,2H3;/b5-3-;;;; |
| InChIKey | YJONFOGGQWWPJG-KTUDTJSXSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|