C29H62OSiSn — CID 11801236
tert-butyl-dimethyl-[(Z,3R)-3-tributylstannylundec-1-enoxy]silane (PubChem CID 11801236) has the molecular formula C29H62OSiSn and a molecular weight of 573.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,3R)-3-tributylstannylundec-1-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,3R)-3-tributylstannylundec-1-enoxy]silane |
|---|---|
| PubChem CID | 11801236 |
| Molecular Formula | C29H62OSiSn |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,3R)-3-tributylstannylundec-1-enoxy]silane |
| SMILES | CCCCCCCC[C@H](/C=C\O[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C17H35OSi.3C4H9.Sn/c1-7-8-9-10-11-12-13-14-15-16-18-19(5,6)17(2,3)4;3*1-3-4-2;/h14-16H,7-13H2,1-6H3;3*1,3-4H2,2H3;/b16-15-;;;; |
| InChIKey | BMDXXUATXDKYQA-HYOPPINZSA-N |
| XLogP | 11.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|