C26H56OSiSn — CID 173153144
tert-butyl-dimethyl-[(3R)-1-tributylstannyloct-1-en-3-yl]oxysilane (PubChem CID 173153144) has the molecular formula C26H56OSiSn and a molecular weight of 531.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R)-1-tributylstannyloct-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R)-1-tributylstannyloct-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 173153144 |
| Molecular Formula | C26H56OSiSn |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | tert-butyl-dimethyl-[(3R)-1-tributylstannyloct-1-en-3-yl]oxysilane |
| SMILES | CCCCC[C@H](C=C[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29OSi.3C4H9.Sn/c1-8-10-11-12-13(9-2)15-16(6,7)14(3,4)5;3*1-3-4-2;/h2,9,13H,8,10-12H2,1,3-7H3;3*1,3-4H2,2H3;/t13-;;;;/m0..../s1 |
| InChIKey | FUTUSXSQAOMLCH-AHJYMZSGSA-N |
| XLogP | 9.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|