C33H72OSiSn2 — CID 11018105
[(E)-3,3-bis(tributylstannyl)prop-1-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11018105) has the molecular formula C33H72OSiSn2 and a molecular weight of 750.45 g/mol. Its IUPAC name is [(E)-3,3-bis(tributylstannyl)prop-1-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-3,3-bis(tributylstannyl)prop-1-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11018105 |
| Molecular Formula | C33H72OSiSn2 |
| Molecular Weight | 750.45 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | [(E)-3,3-bis(tributylstannyl)prop-1-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(/C=C/O[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H18OSi.6C4H9.2Sn/c1-7-8-10-11(5,6)9(2,3)4;6*1-3-4-2;;/h1,7-8H,2-6H3;6*1,3-4H2,2H3;;/b8-7+;;;;;;;; |
| InChIKey | SHYZGEWIHNUYCJ-HORRFMSOSA-N |
| XLogP | 13.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.45 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|