C14H30OSi — CID 101149922
tert-butyl-dimethyl-[(E)-3,4,4-trimethylpent-1-enoxy]silane (PubChem CID 101149922) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-3,4,4-trimethylpent-1-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-3,4,4-trimethylpent-1-enoxy]silane |
|---|---|
| PubChem CID | 101149922 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-3,4,4-trimethylpent-1-enoxy]silane |
| SMILES | CC(/C=C/O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-12(13(2,3)4)10-11-15-16(8,9)14(5,6)7/h10-12H,1-9H3/b11-10+ |
| InChIKey | OIWPUDSUBLROFT-ZHACJKMWSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|