C19H46OSi4 — CID 73443150
tert-butyl-dimethyl-[4,4,4-tris(trimethylsilyl)but-1-enoxy]silane (PubChem CID 73443150) has the molecular formula C19H46OSi4 and a molecular weight of 402.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4,4,4-tris(trimethylsilyl)but-1-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4,4,4-tris(trimethylsilyl)but-1-enoxy]silane |
|---|---|
| PubChem CID | 73443150 |
| Molecular Formula | C19H46OSi4 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl-dimethyl-[4,4,4-tris(trimethylsilyl)but-1-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC=CCC([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H46OSi4/c1-18(2,3)24(13,14)20-17-15-16-19(21(4,5)6,22(7,8)9)23(10,11)12/h15,17H,16H2,1-14H3 |
| InChIKey | KDJHUMQXUAPDAK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|