C14H27NO2Si — CID 101391276
tert-butyl-dimethyl-[(1E,3E)-4-morpholin-4-ylbuta-1,3-dienoxy]silane (PubChem CID 101391276) has the molecular formula C14H27NO2Si and a molecular weight of 269.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1E,3E)-4-morpholin-4-ylbuta-1,3-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1E,3E)-4-morpholin-4-ylbuta-1,3-dienoxy]silane |
|---|---|
| PubChem CID | 101391276 |
| Molecular Formula | C14H27NO2Si |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1E,3E)-4-morpholin-4-ylbuta-1,3-dienoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C/C=C/N1CCOCC1 |
| InChI | InChI=1S/C14H27NO2Si/c1-14(2,3)18(4,5)17-11-7-6-8-15-9-12-16-13-10-15/h6-8,11H,9-10,12-13H2,1-5H3/b8-6+,11-7+ |
| InChIKey | ABZNHZFAHIUISY-JMFBPXTISA-N |
| XLogP | 3.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|