C10H23NOSi — CID 59793232
(Z)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylethenamine (PubChem CID 59793232) has the molecular formula C10H23NOSi and a molecular weight of 201.39 g/mol. Its IUPAC name is (Z)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylethenamine.
| Compound Name | (Z)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 59793232 |
| Molecular Formula | C10H23NOSi |
| Molecular Weight | 201.39 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (Z)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H23NOSi/c1-10(2,3)13(6,7)12-9-8-11(4)5/h8-9H,1-7H3/b9-8- |
| InChIKey | CSDITJSJXOIGLW-HJWRWDBZSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|