C12H24OS2Si — CID 101126959
tert-butyl-dimethyl-[(E)-2-(2-methyl-1,3-dithiolan-2-yl)ethenoxy]silane (PubChem CID 101126959) has the molecular formula C12H24OS2Si and a molecular weight of 276.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-2-(2-methyl-1,3-dithiolan-2-yl)ethenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-2-(2-methyl-1,3-dithiolan-2-yl)ethenoxy]silane |
|---|---|
| PubChem CID | 101126959 |
| Molecular Formula | C12H24OS2Si |
| Molecular Weight | 276.54 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-2-(2-methyl-1,3-dithiolan-2-yl)ethenoxy]silane |
| SMILES | CC1(/C=C/O[Si](C)(C)C(C)(C)C)SCCS1 |
| InChI | InChI=1S/C12H24OS2Si/c1-11(2,3)16(5,6)13-8-7-12(4)14-9-10-15-12/h7-8H,9-10H2,1-6H3/b8-7+ |
| InChIKey | SRUNGMAYTBKXRB-BQYQJAHWSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|