C17H32O2Si — CID 11208694
1-[(1E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dienyl]cyclohexan-1-ol (PubChem CID 11208694) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is 1-[(1E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dienyl]cyclohexan-1-ol.
| Compound Name | 1-[(1E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dienyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11208694 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-[(1E,4E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dienyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C/C/C=C/C1(O)CCCCC1 |
| InChI | InChI=1S/C17H32O2Si/c1-16(2,3)20(4,5)19-15-11-7-10-14-17(18)12-8-6-9-13-17/h10-11,14-15,18H,6-9,12-13H2,1-5H3/b14-10+,15-11+ |
| InChIKey | RGRMRGQZLAEATF-WFYKWJGLSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|