C14H24OS2Si — CID 135038240
tert-butyl-[(1Z)-4-(1,3-dithian-2-ylidene)buta-1,3-dienoxy]-dimethylsilane (PubChem CID 135038240) has the molecular formula C14H24OS2Si and a molecular weight of 300.57 g/mol. Its IUPAC name is tert-butyl-[(1Z)-4-(1,3-dithian-2-ylidene)buta-1,3-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1Z)-4-(1,3-dithian-2-ylidene)buta-1,3-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135038240 |
| Molecular Formula | C14H24OS2Si |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | tert-butyl-[(1Z)-4-(1,3-dithian-2-ylidene)buta-1,3-dienoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C\C=C=C1SCCCS1 |
| InChI | InChI=1S/C14H24OS2Si/c1-14(2,3)18(4,5)15-10-7-6-9-13-16-11-8-12-17-13/h6-7,10H,8,11-12H2,1-5H3/b10-7- |
| InChIKey | LKDBBOOWXZMBEH-YFHOEESVSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|