C14H30O2Si2 — CID 101185110
tert-butyl-dimethyl-[(1E,3Z)-3-trimethylsilyloxypenta-1,3-dienoxy]silane (PubChem CID 101185110) has the molecular formula C14H30O2Si2 and a molecular weight of 286.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1E,3Z)-3-trimethylsilyloxypenta-1,3-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1E,3Z)-3-trimethylsilyloxypenta-1,3-dienoxy]silane |
|---|---|
| PubChem CID | 101185110 |
| Molecular Formula | C14H30O2Si2 |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1E,3Z)-3-trimethylsilyloxypenta-1,3-dienoxy]silane |
| SMILES | C/C=C(/C=C/O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si2/c1-10-13(16-17(5,6)7)11-12-15-18(8,9)14(2,3)4/h10-12H,1-9H3/b12-11+,13-10- |
| InChIKey | WRMRKRMKHHLCHC-NXDNQHQTSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|