C15H33NO2Si2 — CID 11823218
[tert-butyl(dimethyl)silyl] (1Z)-N-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]methanimidate (PubChem CID 11823218) has the molecular formula C15H33NO2Si2 and a molecular weight of 315.61 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (1Z)-N-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]methanimidate.
| Compound Name | [tert-butyl(dimethyl)silyl] (1Z)-N-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]methanimidate |
|---|---|
| PubChem CID | 11823218 |
| Molecular Formula | C15H33NO2Si2 |
| Molecular Weight | 315.61 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (1Z)-N-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]methanimidate |
| SMILES | C=C(/N=C\O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33NO2Si2/c1-13(18-20(10,11)15(5,6)7)16-12-17-19(8,9)14(2,3)4/h12H,1H2,2-11H3/b16-12- |
| InChIKey | IKVKXVXGUAABKU-VBKFSLOCSA-N |
| XLogP | 5.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|