C15H35NOSi2 — CID 529237
[tert-butyl(dimethyl)silyl] N-[tert-butyl(dimethyl)silyl]propanimidate (PubChem CID 529237) has the molecular formula C15H35NOSi2 and a molecular weight of 301.62 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] N-[tert-butyl(dimethyl)silyl]propanimidate.
| Compound Name | [tert-butyl(dimethyl)silyl] N-[tert-butyl(dimethyl)silyl]propanimidate |
|---|---|
| PubChem CID | 529237 |
| Molecular Formula | C15H35NOSi2 |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] N-[tert-butyl(dimethyl)silyl]propanimidate |
| SMILES | CCC(=N[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H35NOSi2/c1-12-13(16-18(8,9)14(2,3)4)17-19(10,11)15(5,6)7/h12H2,1-11H3 |
| InChIKey | GQKSLSXZPFBDOD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|