C29H66N2O3Si4 — CID 11828147
[tert-butyl(dimethyl)silyl] (2S,5E)-2-[[tert-butyl(dimethyl)silyl](15N)amino]-5-[tert-butyl(dimethyl)silyl]imino-5-[tert-butyl(dimethyl)silyl]oxypentanoate (PubChem CID 11828147) has the molecular formula C29H66N2O3Si4 and a molecular weight of 604.20 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2S,5E)-2-[[tert-butyl(dimethyl)silyl](15N)amino]-5-[tert-butyl(dimethyl)silyl]imino-5-[tert-butyl(dimethyl)silyl]oxypentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2S,5E)-2-[[tert-butyl(dimethyl)silyl](15N)amino]-5-[tert-butyl(dimethyl)silyl]imino-5-[tert-butyl(dimethyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 11828147 |
| Molecular Formula | C29H66N2O3Si4 |
| Molecular Weight | 604.20 g/mol |
| Exact Mass | 603.41 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2S,5E)-2-[[tert-butyl(dimethyl)silyl](15N)amino]-5-[tert-butyl(dimethyl)silyl]imino-5-[tert-butyl(dimethyl)silyl]oxypentanoate |
| SMILES | CC(C)(C)[Si](C)(C)/N=C(\CC[C@H]([15NH][Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H66N2O3Si4/c1-26(2,3)35(13,14)30-23(25(32)34-38(19,20)29(10,11)12)21-22-24(31-36(15,16)27(4,5)6)33-37(17,18)28(7,8)9/h23,30H,21-22H2,1-20H3/b31-24+/t23-/m0/s1/i30+1 |
| InChIKey | VZLZLXHLNOEJHY-MQAPNWILSA-N |
| XLogP | 9.70 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.20 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|