C19H39N3O2Si2 — CID 552682
[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-(3-methylimidazol-4-yl)propanoate (PubChem CID 552682) has the molecular formula C19H39N3O2Si2 and a molecular weight of 397.71 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-(3-methylimidazol-4-yl)propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-(3-methylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 552682 |
| Molecular Formula | C19H39N3O2Si2 |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-(3-methylimidazol-4-yl)propanoate |
| SMILES | Cn1cncc1CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39N3O2Si2/c1-18(2,3)25(8,9)21-16(12-15-13-20-14-22(15)7)17(23)24-26(10,11)19(4,5)6/h13-14,16,21H,12H2,1-11H3 |
| InChIKey | TYVRDMHJIRFNSI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|