C17H39NO4SSi2 — CID 553587
[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-4-methylsulfonylbutanoate (PubChem CID 553587) has the molecular formula C17H39NO4SSi2 and a molecular weight of 409.74 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-4-methylsulfonylbutanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 553587 |
| Molecular Formula | C17H39NO4SSi2 |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-4-methylsulfonylbutanoate |
| SMILES | CC(C)(C)[Si](C)(C)NC(CCS(C)(=O)=O)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H39NO4SSi2/c1-16(2,3)24(8,9)18-14(12-13-23(7,20)21)15(19)22-25(10,11)17(4,5)6/h14,18H,12-13H2,1-11H3 |
| InChIKey | HAQQPCKTBFLPMV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|