C16H37NO3Si2 — CID 91696881
[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-methoxypropanoate (PubChem CID 91696881) has the molecular formula C16H37NO3Si2 and a molecular weight of 347.65 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-methoxypropanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-methoxypropanoate |
|---|---|
| PubChem CID | 91696881 |
| Molecular Formula | C16H37NO3Si2 |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-3-methoxypropanoate |
| SMILES | COCC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H37NO3Si2/c1-15(2,3)21(8,9)17-13(12-19-7)14(18)20-22(10,11)16(4,5)6/h13,17H,12H2,1-11H3 |
| InChIKey | KUTMKBOEJQWBOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|