C22H50N2O3Si3 — CID 22212014
[tert-butyl(dimethyl)silyl] (2S)-2,4-bis[[tert-butyl(dimethyl)silyl]amino]-4-oxobutanoate (PubChem CID 22212014) has the molecular formula C22H50N2O3Si3 and a molecular weight of 474.91 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2S)-2,4-bis[[tert-butyl(dimethyl)silyl]amino]-4-oxobutanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2S)-2,4-bis[[tert-butyl(dimethyl)silyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 22212014 |
| Molecular Formula | C22H50N2O3Si3 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2S)-2,4-bis[[tert-butyl(dimethyl)silyl]amino]-4-oxobutanoate |
| SMILES | CC(C)(C)[Si](C)(C)NC(=O)C[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H50N2O3Si3/c1-20(2,3)28(10,11)23-17(19(26)27-30(14,15)22(7,8)9)16-18(25)24-29(12,13)21(4,5)6/h17,23H,16H2,1-15H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | QOAONZDISIOCNC-KRWDZBQOSA-N |
| XLogP | 6.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|