C23H51NO4Si3 — CID 91753821
bis[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-2-methylbutanedioate (PubChem CID 91753821) has the molecular formula C23H51NO4Si3 and a molecular weight of 489.92 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-2-methylbutanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-2-methylbutanedioate |
|---|---|
| PubChem CID | 91753821 |
| Molecular Formula | C23H51NO4Si3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]amino]-2-methylbutanedioate |
| SMILES | CC(CC(=O)O[Si](C)(C)C(C)(C)C)(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H51NO4Si3/c1-20(2,3)29(11,12)24-23(10,19(26)28-31(15,16)22(7,8)9)17-18(25)27-30(13,14)21(4,5)6/h24H,17H2,1-16H3 |
| InChIKey | OMLIHQHGHIEPJT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|