C8H19O5PSi — CID 58473369
[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]phosphonic acid (PubChem CID 58473369) has the molecular formula C8H19O5PSi and a molecular weight of 254.29 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 58473369 |
| Molecular Formula | C8H19O5PSi |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]phosphonic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O)O |
| InChI | InChI=1S/C8H19O5PSi/c1-8(2,3)15(4,5)13-7(9)6-14(10,11)12/h6H2,1-5H3,(H2,10,11,12) |
| InChIKey | DNHLAVQZIYSXKP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|