About [tert-butyl(dimethyl)silyl] 5-fluoropentanoate
[tert-butyl(dimethyl)silyl] 5-fluoropentanoate (PubChem CID 87739176) has the molecular formula C11H23FO2Si
and a molecular weight of 234.39 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 5-fluoropentanoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 5-fluoropentanoate |
| PubChem CID | 87739176 |
| Molecular Formula | C11H23FO2Si |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 5-fluoropentanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CCCCF |
| InChI | InChI=1S/C11H23FO2Si/c1-11(2,3)15(4,5)14-10(13)8-6-7-9-12/h6-9H2,1-5H3 |
| InChIKey | CDALJFVOHUXXCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 5-fluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 5-fluoropentanoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 5-fluoropentanoate (CID 87739176) is [tert-butyl(dimethyl)silyl] 5-fluoropentanoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 5-fluoropentanoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 5-fluoropentanoate is CC(C)(C)[Si](C)(C)OC(=O)CCCCF.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 5-fluoropentanoate?
The InChIKey is CDALJFVOHUXXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23FO2Si/c1-11(2,3)15(4,5)14-10(13)8-6-7-9-12/h6-9H2,1-5H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 5-fluoropentanoate?
[tert-butyl(dimethyl)silyl] 5-fluoropentanoate has a molecular weight of 234.39 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 5-fluoropentanoate is sourced from PubChem (CID 87739176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).