C23H52N2O3Si3 — CID 553965
[tert-butyl(dimethyl)silyl] 2,5-bis[[tert-butyl(dimethyl)silyl]amino]-5-oxopentanoate (PubChem CID 553965) has the molecular formula C23H52N2O3Si3 and a molecular weight of 488.94 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2,5-bis[[tert-butyl(dimethyl)silyl]amino]-5-oxopentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2,5-bis[[tert-butyl(dimethyl)silyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 553965 |
| Molecular Formula | C23H52N2O3Si3 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2,5-bis[[tert-butyl(dimethyl)silyl]amino]-5-oxopentanoate |
| SMILES | CC(C)(C)[Si](C)(C)NC(=O)CCC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H52N2O3Si3/c1-21(2,3)29(10,11)24-18(20(27)28-31(14,15)23(7,8)9)16-17-19(26)25-30(12,13)22(4,5)6/h18,24H,16-17H2,1-15H3,(H,25,26) |
| InChIKey | SCHQVORKBCRFQF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|