C30H70N4O2Si4 — CID 529516
[tert-butyl(dimethyl)silyl] 5-[bis[[tert-butyl(dimethyl)silyl]amino]methylideneamino]-2-[[tert-butyl(dimethyl)silyl]amino]pentanoate (PubChem CID 529516) has the molecular formula C30H70N4O2Si4 and a molecular weight of 631.26 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 5-[bis[[tert-butyl(dimethyl)silyl]amino]methylideneamino]-2-[[tert-butyl(dimethyl)silyl]amino]pentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 5-[bis[[tert-butyl(dimethyl)silyl]amino]methylideneamino]-2-[[tert-butyl(dimethyl)silyl]amino]pentanoate |
|---|---|
| PubChem CID | 529516 |
| Molecular Formula | C30H70N4O2Si4 |
| Molecular Weight | 631.26 g/mol |
| Exact Mass | 630.46 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 5-[bis[[tert-butyl(dimethyl)silyl]amino]methylideneamino]-2-[[tert-butyl(dimethyl)silyl]amino]pentanoate |
| SMILES | CC(C)(C)[Si](C)(C)NC(=NCCCC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H70N4O2Si4/c1-27(2,3)37(13,14)32-24(25(35)36-40(19,20)30(10,11)12)22-21-23-31-26(33-38(15,16)28(4,5)6)34-39(17,18)29(7,8)9/h24,32H,21-23H2,1-20H3,(H2,31,33,34) |
| InChIKey | KZOXLIRXWFDVSM-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.26 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|