C26H54O4Si2 — CID 87528223
methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-dimethylnon-2-enoate (PubChem CID 87528223) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-dimethylnon-2-enoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-dimethylnon-2-enoate |
|---|---|
| PubChem CID | 87528223 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-dimethylnon-2-enoate |
| SMILES | COC(=O)C(CCO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(C)CCCC(C)C |
| InChI | InChI=1S/C26H54O4Si2/c1-20(2)16-15-17-21(3)23(30-32(13,14)26(7,8)9)22(24(27)28-10)18-19-29-31(11,12)25(4,5)6/h20-21H,15-19H2,1-14H3 |
| InChIKey | RAYRDHDHBIYHCP-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|