C17H36O4Si — CID 138968890
(3R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,5-dimethylheptan-4-one (PubChem CID 138968890) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is (3R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,5-dimethylheptan-4-one.
| Compound Name | (3R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,5-dimethylheptan-4-one |
|---|---|
| PubChem CID | 138968890 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3R,5S)-7-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,5-dimethylheptan-4-one |
| SMILES | COC(C[C@@H](C)C(=O)[C@@H](C)CCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C17H36O4Si/c1-13(10-11-21-22(8,9)17(3,4)5)16(18)14(2)12-15(19-6)20-7/h13-15H,10-12H2,1-9H3/t13-,14+/m0/s1 |
| InChIKey | RSZOEFKGKZHYPJ-UONOGXRCSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|