C22H51O5PSi3 — CID 91745490
[tert-butyl(dimethyl)silyl] 2-bis[[tert-butyl(dimethyl)silyl]oxy]phosphorylbutanoate (PubChem CID 91745490) has the molecular formula C22H51O5PSi3 and a molecular weight of 510.88 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-bis[[tert-butyl(dimethyl)silyl]oxy]phosphorylbutanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-bis[[tert-butyl(dimethyl)silyl]oxy]phosphorylbutanoate |
|---|---|
| PubChem CID | 91745490 |
| Molecular Formula | C22H51O5PSi3 |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-bis[[tert-butyl(dimethyl)silyl]oxy]phosphorylbutanoate |
| SMILES | CCC(C(=O)O[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H51O5PSi3/c1-17-18(19(23)25-29(11,12)20(2,3)4)28(24,26-30(13,14)21(5,6)7)27-31(15,16)22(8,9)10/h18H,17H2,1-16H3 |
| InChIKey | YUUMOIPQRNNCMM-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|