C9H15N3O2 — CID 66117010
methyl 2-(aminomethyl)-3-(3-methylimidazol-4-yl)propanoate (PubChem CID 66117010) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-3-(3-methylimidazol-4-yl)propanoate.
| Compound Name | methyl 2-(aminomethyl)-3-(3-methylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 66117010 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | methyl 2-(aminomethyl)-3-(3-methylimidazol-4-yl)propanoate |
| SMILES | COC(=O)C(CN)Cc1cncn1C |
| InChI | InChI=1S/C9H15N3O2/c1-12-6-11-5-8(12)3-7(4-10)9(13)14-2/h5-7H,3-4,10H2,1-2H3 |
| InChIKey | XUFRLSWVIJDCEW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |