About methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate
methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate (PubChem CID 25137520) has the molecular formula C23H33N3O2S
and a molecular weight of 415.60 g/mol. Its IUPAC name is methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
| PubChem CID | 25137520 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cncn1C)NC(=S)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33N3O2S/c1-22(2,3)16-9-15(10-17(11-16)23(4,5)6)20(29)25-19(21(27)28-8)12-18-13-24-14-26(18)7/h9-11,13-14,19H,12H2,1-8H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | FNAKMYWJXIEXAN-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate?
The IUPAC name of methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate (CID 25137520) is methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate.
What is the SMILES notation for methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate?
The canonical SMILES for methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate is COC(=O)[C@H](Cc1cncn1C)NC(=S)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate?
The InChIKey is FNAKMYWJXIEXAN-IBGZPJMESA-N. The full InChI is InChI=1S/C23H33N3O2S/c1-22(2,3)16-9-15(10-17(11-16)23(4,5)6)20(29)25-19(21(27)28-8)12-18-13-24-14-26(18)7/h9-11,13-14,19H,12H2,1-8H3,(H,25,29)/t19-/m0/s1.
What are the key properties of methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate?
methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate has a molecular weight of 415.60 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate is sourced from PubChem (CID 25137520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).