C23H33N3O2S — CID 25137520
methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate (PubChem CID 25137520) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate.
| Compound Name | methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 25137520 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | methyl (2S)-2-[(3,5-ditert-butylbenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cncn1C)NC(=S)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33N3O2S/c1-22(2,3)16-9-15(10-17(11-16)23(4,5)6)20(29)25-19(21(27)28-8)12-18-13-24-14-26(18)7/h9-11,13-14,19H,12H2,1-8H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | FNAKMYWJXIEXAN-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|