C23H33N3O3S — CID 135869190
methyl (2S)-2-[(3,5-ditert-butyl-2-hydroxybenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate (PubChem CID 135869190) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is methyl (2S)-2-[(3,5-ditert-butyl-2-hydroxybenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate.
| Compound Name | methyl (2S)-2-[(3,5-ditert-butyl-2-hydroxybenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 135869190 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methyl (2S)-2-[(3,5-ditert-butyl-2-hydroxybenzenecarbothioyl)amino]-3-(3-methylimidazol-4-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cncn1C)NC(=S)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H33N3O3S/c1-22(2,3)14-9-16(19(27)17(10-14)23(4,5)6)20(30)25-18(21(28)29-8)11-15-12-24-13-26(15)7/h9-10,12-13,18,27H,11H2,1-8H3,(H,25,30)/t18-/m0/s1 |
| InChIKey | CAAMXWIMVIRASV-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|