C14H23N3O4 — CID 101108513
methyl (2S)-3-(2-tert-butyl-3-methylimidazol-4-yl)-2-(methoxycarbonylamino)propanoate (PubChem CID 101108513) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is methyl (2S)-3-(2-tert-butyl-3-methylimidazol-4-yl)-2-(methoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(2-tert-butyl-3-methylimidazol-4-yl)-2-(methoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 101108513 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | methyl (2S)-3-(2-tert-butyl-3-methylimidazol-4-yl)-2-(methoxycarbonylamino)propanoate |
| SMILES | COC(=O)N[C@@H](Cc1cnc(C(C)(C)C)n1C)C(=O)OC |
| InChI | InChI=1S/C14H23N3O4/c1-14(2,3)12-15-8-9(17(12)4)7-10(11(18)20-5)16-13(19)21-6/h8,10H,7H2,1-6H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | YTDUBGDANXIKKH-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |