C13H21N3O7 — CID 178139552
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(trihydroxymethyl)pyrazol-4-yl]propanoate (PubChem CID 178139552) has the molecular formula C13H21N3O7 and a molecular weight of 331.33 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(trihydroxymethyl)pyrazol-4-yl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(trihydroxymethyl)pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 178139552 |
| Molecular Formula | C13H21N3O7 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(trihydroxymethyl)pyrazol-4-yl]propanoate |
| SMILES | COC(=O)C(Cc1cnn(C(O)(O)O)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21N3O7/c1-12(2,3)23-11(18)15-9(10(17)22-4)5-8-6-14-16(7-8)13(19,20)21/h6-7,9,19-21H,5H2,1-4H3,(H,15,18) |
| InChIKey | UJOIKCKARGMOCZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|