C21H29N3O6 — CID 166810327
tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indazole-1-carboxylate (PubChem CID 166810327) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 166810327 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indazole-1-carboxylate |
| SMILES | COC(=O)[C@H](Cc1ccc2c(cnn2C(=O)OC(C)(C)C)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29N3O6/c1-20(2,3)29-18(26)23-15(17(25)28-7)11-13-8-9-16-14(10-13)12-22-24(16)19(27)30-21(4,5)6/h8-10,12,15H,11H2,1-7H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | QHNNIYKFJKYZET-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|